Products 2169089-81-8

CAS 2169089-81-8 is the registry number for 2-(4-Methoxypyridin-2-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-methoxy-2-pyridinyl)-1,3-thiazole-4-carboxylic acid (CAS 2169089-81-8) is a chemical compound with the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. IUPAC name: 2-(4-methoxy-2-pyridinyl)-1,3-thiazole-4-carboxylic acid. InChIKey: NYOWEIXAYFCIPI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8N2O3S
Molecular weight236.25 g/mol
IUPAC name2-(4-methoxy-2-pyridinyl)-1,3-thiazole-4-carboxylic acid
InChIKeyNYOWEIXAYFCIPI-UHFFFAOYSA-N
SMILESCOC1=CC(=NC=C1)C2=NC(=CS2)C(=O)O

Computed by PubChem (NCBI)