CAS 432013-04-2 is the registry number for 3-((4-Oxo-4,5-dihydrothiazol-2-yl)amino)benzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoic acid (CAS 432013-04-2) is a chemical compound with the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. IUPAC name: 3-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoic acid. InChIKey: HTKXUEDHHKANNP-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3S |
|---|---|
| Molecular weight | 236.25 g/mol |
| IUPAC name | 3-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoic acid |
| InChIKey | HTKXUEDHHKANNP-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=NC2=CC=CC(=C2)C(=O)O)S1 |
Computed by PubChem (NCBI)