CAS 99361-50-9 appears in our catalog under these names: (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)-acetic acid, 95%, (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)-acetic acid, 95%, 95%, (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)-acetic acid, 2-((5-Phenyl-1,3,4-oxadiazol-2-yl)thio)acetic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid (CAS 99361-50-9) is a chemical compound with the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. IUPAC name: 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid. InChIKey: VKPCKQCSWWCRFI-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3S |
|---|---|
| Molecular weight | 236.25 g/mol |
| IUPAC name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid |
| InChIKey | VKPCKQCSWWCRFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)SCC(=O)O |
Computed by PubChem (NCBI)