Products 2169469-26-3
CAS 2169469-26-3 is the registry number for 7-Amino-4,4-dimethyl-3,4-dihydroquinazolin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one (CAS 2169469-26-3) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. IUPAC name: 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one. InChIKey: RYGQDMABHVUNOL-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one |
| InChIKey | RYGQDMABHVUNOL-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)N)NC(=O)N1)C |
Computed by PubChem (NCBI)