Products 2169568-00-5
CAS 2169568-00-5 is the registry number for 2-(1,3-Dioxolan-2-yl)-1,3-thiazole-5-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1,3-dioxolan-2-yl)-1,3-thiazole-5-sulfonamide (CAS 2169568-00-5) is a chemical compound with the molecular formula C6H8N2O4S2 and a molecular weight of 236.3 g/mol. IUPAC name: 2-(1,3-dioxolan-2-yl)-1,3-thiazole-5-sulfonamide. InChIKey: PODRTLXZLXJQHD-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | 2-(1,3-dioxolan-2-yl)-1,3-thiazole-5-sulfonamide |
| InChIKey | PODRTLXZLXJQHD-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=NC=C(S2)S(=O)(=O)N |
Computed by PubChem (NCBI)