Products 2169877-22-7
CAS 2169877-22-7 appears in our catalog under these names: 5-(1,1-Dimethylethyl) 2-pentenedioate, 98%, 5-(1,1-Dimethylethyl) 2-pentenedioate, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
(E)-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-2-enoic acid (CAS 2169877-22-7) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: (E)-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-2-enoic acid. InChIKey: RVUUNPJCDTWMPE-SNAWJCMRSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | (E)-5-[(2-methylpropan-2-yl)oxy]-5-oxopent-2-enoic acid |
| InChIKey | RVUUNPJCDTWMPE-SNAWJCMRSA-N |
| SMILES | CC(C)(C)OC(=O)C/C=C/C(=O)O |
Computed by PubChem (NCBI)