CAS 2170088-97-6 is the registry number for Ferulic Acid Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
(2-acetyl-5-methoxyphenyl) (E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoate (CAS 2170088-97-6) is a chemical compound with the molecular formula C21H20O7 and a molecular weight of 384.4 g/mol. IUPAC name: (2-acetyl-5-methoxyphenyl) (E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoate. InChIKey: CNUUXDQPUCQBFB-UXBLZVDNSA-N.
| Molecular formula | C21H20O7 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | (2-acetyl-5-methoxyphenyl) (E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | CNUUXDQPUCQBFB-UXBLZVDNSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)OC)OC(=O)/C=C/C2=CC(=C(C=C2)OC(=O)C)OC |
Computed by PubChem (NCBI)