Products 65998-43-8
CAS 65998-43-8 is the registry number for 3-(4-(Acetyloxy)phenyl)-3,4-dihydro-2H-1-benzopyran-5,7-diol Diacetate. Offered by: TRC. Available pack sizes: 100mg.
[4-(5,7-diacetyloxy-3,4-dihydro-2H-chromen-3-yl)phenyl] acetate (CAS 65998-43-8) is a chemical compound with the molecular formula C21H20O7 and a molecular weight of 384.4 g/mol. IUPAC name: [4-(5,7-diacetyloxy-3,4-dihydro-2H-chromen-3-yl)phenyl] acetate. InChIKey: ZNLONMAGZHFRRE-UHFFFAOYSA-N.
| Molecular formula | C21H20O7 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | [4-(5,7-diacetyloxy-3,4-dihydro-2H-chromen-3-yl)phenyl] acetate |
| InChIKey | ZNLONMAGZHFRRE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2CC3=C(C=C(C=C3OC(=O)C)OC(=O)C)OC2 |
Computed by PubChem (NCBI)