CAS 78804-17-8 appears in our catalog under these names: ((1R,2S,5R,6S)-5-(Benzoyloxy)-1,2,6-trihydroxycyclohex-3-en-1-yl)methyl benzoate, 95%, Zeylenol, (-)-Zeylenol, ((1R,2S,5R,6S)-5-(Benzoyloxy)-1,2,6-trihydroxycyclohex-3-en-1-yl)methyl benzoate, ≥95%, ≥95%, (-)-Zeylenol, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 10mg, 50mg, 5mg, 1 mg, 5 mg.
[(1R,2S,5R,6S)-5-benzoyloxy-1,2,6-trihydroxycyclohex-3-en-1-yl]methyl benzoate (CAS 78804-17-8) is a chemical compound with the molecular formula C21H20O7 and a molecular weight of 384.4 g/mol. IUPAC name: [(1R,2S,5R,6S)-5-benzoyloxy-1,2,6-trihydroxycyclohex-3-en-1-yl]methyl benzoate. InChIKey: AWCUZBLYCWUTRL-OEMYIYORSA-N.
| Molecular formula | C21H20O7 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | [(1R,2S,5R,6S)-5-benzoyloxy-1,2,6-trihydroxycyclohex-3-en-1-yl]methyl benzoate |
| InChIKey | AWCUZBLYCWUTRL-OEMYIYORSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@]2([C@H](C=C[C@H]([C@@H]2O)OC(=O)C3=CC=CC=C3)O)O |
Computed by PubChem (NCBI)