Products 2170180-18-2
CAS 2170180-18-2 is the registry number for 4-Methyl-3-oxo-4-(2H-1,2,3-triazol-2-yl)pentanenitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-3-oxo-4-(triazol-2-yl)pentanenitrile (CAS 2170180-18-2) is a chemical compound with the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. IUPAC name: 4-methyl-3-oxo-4-(triazol-2-yl)pentanenitrile. InChIKey: XMGHHYHMIVYUPF-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 4-methyl-3-oxo-4-(triazol-2-yl)pentanenitrile |
| InChIKey | XMGHHYHMIVYUPF-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)CC#N)N1N=CC=N1 |
Computed by PubChem (NCBI)