CAS 2170530-54-6 appears in our catalog under these names: Rel-(1R,5S,6s)-3-methyl-3-azabicyclo(3.1.0)hexane-6-carboxylic acid hydrochloride, 97%, rel-(1R,5S,6s)-3-methyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid,hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid;hydrochloride (CAS 2170530-54-6) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: (1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid;hydrochloride. InChIKey: HODLKSZWQIRKJQ-FTEHNKOGSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | (1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid;hydrochloride |
| InChIKey | HODLKSZWQIRKJQ-FTEHNKOGSA-N |
| SMILES | CN1C[C@@H]2[C@H](C1)C2C(=O)O.Cl |
Computed by PubChem (NCBI)