CAS 2170761-55-2 appears in our catalog under these names: Brivaracetam Impurity 29, (AlphaS)-Alpha-Ethyl-2,5-dihydro-2-oxo-4-propyl-1H-pyrrole-1-acetic Acid, (aS)-a-Ethyl-2,5-dihydro-2-oxo-4-propyl-1H-pyrrole-1-acetic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 50mg.
(2S)-2-(5-oxo-3-propyl-2H-pyrrol-1-yl)butanoic acid (CAS 2170761-55-2) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: (2S)-2-(5-oxo-3-propyl-2H-pyrrol-1-yl)butanoic acid. InChIKey: MNAAEDCAWCQFEV-VIFPVBQESA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | (2S)-2-(5-oxo-3-propyl-2H-pyrrol-1-yl)butanoic acid |
| InChIKey | MNAAEDCAWCQFEV-VIFPVBQESA-N |
| SMILES | CCCC1=CC(=O)N(C1)[C@@H](CC)C(=O)O |
Computed by PubChem (NCBI)