CAS 2172218-68-5 appears in our catalog under these names: 5-(Aminomethyl)-3,4-dihydro-2H-1,4-benzoxazin-3-one hydrochloride, 95%, 5-(Aminomethyl)-3,4-dihydro-2H-1,4-benzoxazin-3-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(aminomethyl)-4H-1,4-benzoxazin-3-one;hydrochloride (CAS 2172218-68-5) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 5-(aminomethyl)-4H-1,4-benzoxazin-3-one;hydrochloride. InChIKey: LAFDUNCEBZGQGJ-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 5-(aminomethyl)-4H-1,4-benzoxazin-3-one;hydrochloride |
| InChIKey | LAFDUNCEBZGQGJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=CC=C2O1)CN.Cl |
Computed by PubChem (NCBI)