Products 2172254-22-5
CAS 2172254-22-5 is the registry number for 1-(1,2,3,6-Tetrahydropyridin-4-yl)cyclopropane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1,2,3,6-tetrahydropyridin-4-yl)cyclopropane-1-carboxylic acid;hydrochloride (CAS 2172254-22-5) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: 1-(1,2,3,6-tetrahydropyridin-4-yl)cyclopropane-1-carboxylic acid;hydrochloride. InChIKey: DEXNXBBCDPRKGM-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 1-(1,2,3,6-tetrahydropyridin-4-yl)cyclopropane-1-carboxylic acid;hydrochloride |
| InChIKey | DEXNXBBCDPRKGM-UHFFFAOYSA-N |
| SMILES | C1CNCC=C1C2(CC2)C(=O)O.Cl |
Computed by PubChem (NCBI)