Products 2172493-54-6
CAS 2172493-54-6 is the registry number for (3-(Pentafluoroethyl)phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methanamine;hydrochloride (CAS 2172493-54-6) is a chemical compound with the molecular formula C9H9ClF5N and a molecular weight of 261.62 g/mol. IUPAC name: [3-(1,1,2,2,2-pentafluoroethyl)phenyl]methanamine;hydrochloride. InChIKey: HIGVJMUNPQIUEV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF5N |
|---|---|
| Molecular weight | 261.62 g/mol |
| IUPAC name | [3-(1,1,2,2,2-pentafluoroethyl)phenyl]methanamine;hydrochloride |
| InChIKey | HIGVJMUNPQIUEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(C(F)(F)F)(F)F)CN.Cl |
Computed by PubChem (NCBI)