CAS 2248172-18-9 is the registry number for (1R)-2,2-Difluoro-1-(2-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R)-2,2-difluoro-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 2248172-18-9) is a chemical compound with the molecular formula C9H9ClF5N and a molecular weight of 261.62 g/mol. IUPAC name: (1R)-2,2-difluoro-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: STQLRWXDMRHOJV-OGFXRTJISA-N.
| Molecular formula | C9H9ClF5N |
|---|---|
| Molecular weight | 261.62 g/mol |
| IUPAC name | (1R)-2,2-difluoro-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | STQLRWXDMRHOJV-OGFXRTJISA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(F)F)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)