CAS 2248284-03-7 is the registry number for 2,2-Difluoro-1-(3-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2-difluoro-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 2248284-03-7) is a chemical compound with the molecular formula C9H9ClF5N and a molecular weight of 261.62 g/mol. IUPAC name: 2,2-difluoro-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: HOSGUHSZHHQLIO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF5N |
|---|---|
| Molecular weight | 261.62 g/mol |
| IUPAC name | 2,2-difluoro-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | HOSGUHSZHHQLIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(C(F)F)N.Cl |
Computed by PubChem (NCBI)