Products 2172503-71-6

CAS 2172503-71-6 is the registry number for 2-Phenyloxane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-phenyloxane-2-carboxylic acid (CAS 2172503-71-6) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2-phenyloxane-2-carboxylic acid. InChIKey: RPDIVAZCAWHTTK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O3
Molecular weight206.24 g/mol
IUPAC name2-phenyloxane-2-carboxylic acid
InChIKeyRPDIVAZCAWHTTK-UHFFFAOYSA-N
SMILESC1CCOC(C1)(C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)