CAS 2173136-94-0 appears in our catalog under these names: 4,6,9-Trimethyl[1,2,4]triazolo[4,3-a]quinoline-1-thiol, 95%, 4,6,9-Trimethyl(1,2,4)triazolo(4,3-a)quinoline-1-thiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4,6,9-trimethyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione (CAS 2173136-94-0) is a chemical compound with the molecular formula C13H13N3S and a molecular weight of 243.33 g/mol. IUPAC name: 4,6,9-trimethyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione. InChIKey: AQHCBBQWLVODKG-UHFFFAOYSA-N.
| Molecular formula | C13H13N3S |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | 4,6,9-trimethyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione |
| InChIKey | AQHCBBQWLVODKG-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C3=NNC(=S)N3C2=C(C=C1)C)C |
Computed by PubChem (NCBI)