Products 315677-92-0
CAS 315677-92-0 appears in our catalog under these names: 5,7,9-Trimethyl-[1,2,4]triazolo[4,3-a]quinoline-1-thiol, 95%, 5,7,9-Trimethyl-(1,2,4)triazolo(4,3-a)quinoline-1-thiol, 95%, 5,7,9-Trimethyl-(1,2,4)triazolo(4,3-a)quinoline-1-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
5,7,9-trimethyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione (CAS 315677-92-0) is a chemical compound with the molecular formula C13H13N3S and a molecular weight of 243.33 g/mol. IUPAC name: 5,7,9-trimethyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione. InChIKey: ICVNTNDWRJGXMB-UHFFFAOYSA-N.
| Molecular formula | C13H13N3S |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | 5,7,9-trimethyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione |
| InChIKey | ICVNTNDWRJGXMB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC3=NNC(=S)N32)C)C |
Computed by PubChem (NCBI)