CAS 893730-53-5 is the registry number for 4-(2,5-Dimethyl-1h-indol-3-yl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4-(2,5-dimethyl-1H-indol-3-yl)-1,3-thiazol-2-amine (CAS 893730-53-5) is a chemical compound with the molecular formula C13H13N3S and a molecular weight of 243.33 g/mol. IUPAC name: 4-(2,5-dimethyl-1H-indol-3-yl)-1,3-thiazol-2-amine. InChIKey: UBZJWYAZTJLXIP-UHFFFAOYSA-N.
| Molecular formula | C13H13N3S |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | 4-(2,5-dimethyl-1H-indol-3-yl)-1,3-thiazol-2-amine |
| InChIKey | UBZJWYAZTJLXIP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=C2C3=CSC(=N3)N)C |
Computed by PubChem (NCBI)