Products 2173177-02-9
CAS 2173177-02-9 is the registry number for (4-(cyclopropylmethoxy)-2,3-difluorophenyl)boronic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[4-(cyclopropylmethoxy)-2,3-difluorophenyl]boronic acid (CAS 2173177-02-9) is a chemical compound with the molecular formula C10H11BF2O3 and a molecular weight of 228.00 g/mol. IUPAC name: [4-(cyclopropylmethoxy)-2,3-difluorophenyl]boronic acid. InChIKey: PBFLOZREEBQWSE-UHFFFAOYSA-N.
| Molecular formula | C10H11BF2O3 |
|---|---|
| Molecular weight | 228.00 g/mol |
| IUPAC name | [4-(cyclopropylmethoxy)-2,3-difluorophenyl]boronic acid |
| InChIKey | PBFLOZREEBQWSE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC2CC2)F)F)(O)O |
Computed by PubChem (NCBI)