Products 217326-48-2

CAS 217326-48-2 is the registry number for (S)-1-((3,5-Dichlorophenyl)sulfonyl)pyrrolidine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 217326-48-2) is a chemical compound with the molecular formula C11H11Cl2NO4S and a molecular weight of 324.2 g/mol. IUPAC name: (2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: SRQOBFXQILTASR-JTQLQIEISA-N.

Identity
Molecular formulaC11H11Cl2NO4S
Molecular weight324.2 g/mol
IUPAC name(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid
InChIKeySRQOBFXQILTASR-JTQLQIEISA-N
SMILESC1C[C@H](N(C1)S(=O)(=O)C2=CC(=CC(=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)