CAS 474376-21-1 is the registry number for 1-[(3,4-Dichlorophenyl)sulfonyl]proline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3,4-dichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 474376-21-1) is a chemical compound with the molecular formula C11H11Cl2NO4S and a molecular weight of 324.2 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: SBHJWGVUVFVDMN-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO4S |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | SBHJWGVUVFVDMN-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)S(=O)(=O)C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)