Products 474376-21-1

CAS 474376-21-1 is the registry number for 1-[(3,4-Dichlorophenyl)sulfonyl]proline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(3,4-dichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 474376-21-1) is a chemical compound with the molecular formula C11H11Cl2NO4S and a molecular weight of 324.2 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: SBHJWGVUVFVDMN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11Cl2NO4S
Molecular weight324.2 g/mol
IUPAC name1-(3,4-dichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid
InChIKeySBHJWGVUVFVDMN-UHFFFAOYSA-N
SMILESC1CC(N(C1)S(=O)(=O)C2=CC(=C(C=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)