Products 351336-24-8

CAS 351336-24-8 is the registry number for 2,4-Dichloro-5-(pyrrolidine-1-sulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-pyrrolidin-1-ylsulfonylbenzoic acid (CAS 351336-24-8) is a chemical compound with the molecular formula C11H11Cl2NO4S and a molecular weight of 324.2 g/mol. IUPAC name: 2,4-dichloro-5-pyrrolidin-1-ylsulfonylbenzoic acid. InChIKey: FENBWHWVQLQVJE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11Cl2NO4S
Molecular weight324.2 g/mol
IUPAC name2,4-dichloro-5-pyrrolidin-1-ylsulfonylbenzoic acid
InChIKeyFENBWHWVQLQVJE-UHFFFAOYSA-N
SMILESC1CCN(C1)S(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)