CAS 351336-24-8 is the registry number for 2,4-Dichloro-5-(pyrrolidine-1-sulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2,4-dichloro-5-pyrrolidin-1-ylsulfonylbenzoic acid (CAS 351336-24-8) is a chemical compound with the molecular formula C11H11Cl2NO4S and a molecular weight of 324.2 g/mol. IUPAC name: 2,4-dichloro-5-pyrrolidin-1-ylsulfonylbenzoic acid. InChIKey: FENBWHWVQLQVJE-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO4S |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 2,4-dichloro-5-pyrrolidin-1-ylsulfonylbenzoic acid |
| InChIKey | FENBWHWVQLQVJE-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)