Products 2173637-53-9
CAS 2173637-53-9 appears in our catalog under these names: (R)–3–((tert–Butoxycarbonyl)amino)pyrrolidine–3–carboxylic acid, (3R)-3-{((tert-Butoxy)carbonyl)amino}pyrrolidine-3-carboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-3-carboxylic acid (CAS 2173637-53-9) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-3-carboxylic acid. InChIKey: YYLURLWWCZBOQG-SNVBAGLBSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-3-carboxylic acid |
| InChIKey | YYLURLWWCZBOQG-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(CCNC1)C(=O)O |
Computed by PubChem (NCBI)