CAS 2173637-87-9 is the registry number for 3-{((2R,4R)-4-Methoxypyrrolidin-2-yl)methoxy}pyridine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[[(2R,4R)-4-methoxypyrrolidin-2-yl]methoxy]pyridine;dihydrochloride (CAS 2173637-87-9) is a chemical compound with the molecular formula C11H18Cl2N2O2 and a molecular weight of 281.18 g/mol. IUPAC name: 3-[[(2R,4R)-4-methoxypyrrolidin-2-yl]methoxy]pyridine;dihydrochloride. InChIKey: OMBXZSPPBXABFA-XFQLJVDGSA-N.
| Molecular formula | C11H18Cl2N2O2 |
|---|---|
| Molecular weight | 281.18 g/mol |
| IUPAC name | 3-[[(2R,4R)-4-methoxypyrrolidin-2-yl]methoxy]pyridine;dihydrochloride |
| InChIKey | OMBXZSPPBXABFA-XFQLJVDGSA-N |
| SMILES | CO[C@@H]1C[C@@H](NC1)COC2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)