CAS 2173992-22-6 appears in our catalog under these names: 7-Nitroindoline hydrochloride, 95%, 7–Nitroindoline hydrochloride, 2,3-Dihydro-7-nitro-1H-indole hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
7-nitro-2,3-dihydro-1H-indole;hydrochloride (CAS 2173992-22-6) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 7-nitro-2,3-dihydro-1H-indole;hydrochloride. InChIKey: VZHMOVIJXOLTKW-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 7-nitro-2,3-dihydro-1H-indole;hydrochloride |
| InChIKey | VZHMOVIJXOLTKW-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=CC=C2[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)