Products 2173999-44-3
CAS 2173999-44-3 is the registry number for 4-(4-Chlorobenzoyl)-1H-pyrazole hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-chlorophenyl)-(1H-pyrazol-4-yl)methanone;hydrochloride (CAS 2173999-44-3) is a chemical compound with the molecular formula C10H8Cl2N2O and a molecular weight of 243.09 g/mol. IUPAC name: (4-chlorophenyl)-(1H-pyrazol-4-yl)methanone;hydrochloride. InChIKey: AIPMAQBEGHSORX-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | (4-chlorophenyl)-(1H-pyrazol-4-yl)methanone;hydrochloride |
| InChIKey | AIPMAQBEGHSORX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CNN=C2)Cl.Cl |
Computed by PubChem (NCBI)