Products 2173999-85-2
CAS 2173999-85-2 is the registry number for 5-{1-((tert-Butoxy)carbonyl)azetidin-3-yl}-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]-1,3-oxazole-4-carboxylic acid (CAS 2173999-85-2) is a chemical compound with the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. IUPAC name: 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]-1,3-oxazole-4-carboxylic acid. InChIKey: JNJPAUJZTIVGAQ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | JNJPAUJZTIVGAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)