Products 2174002-68-5
CAS 2174002-68-5 is the registry number for rac-tert-Butyl N-((3R,4S)-4-(4-amino-1H-pyrazol-1-yl)oxolan-3-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-[(3S,4R)-4-(4-aminopyrazol-1-yl)oxolan-3-yl]carbamate (CAS 2174002-68-5) is a chemical compound with the molecular formula C12H20N4O3 and a molecular weight of 268.31 g/mol. IUPAC name: tert-butyl N-[(3S,4R)-4-(4-aminopyrazol-1-yl)oxolan-3-yl]carbamate. InChIKey: NAZRJMZPWGYKGP-ZJUUUORDSA-N.
| Molecular formula | C12H20N4O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | tert-butyl N-[(3S,4R)-4-(4-aminopyrazol-1-yl)oxolan-3-yl]carbamate |
| InChIKey | NAZRJMZPWGYKGP-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COC[C@@H]1N2C=C(C=N2)N |
Computed by PubChem (NCBI)