Products 217479-61-3
CAS 217479-61-3 appears in our catalog under these names: 2,4,6-Trichlorobenzyl bromide, 2-(Bromomethyl)-1,3,5-trichlorobenzene, >95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
2-(bromomethyl)-1,3,5-trichlorobenzene (CAS 217479-61-3) is a chemical compound with the molecular formula C7H4BrCl3 and a molecular weight of 274.4 g/mol. IUPAC name: 2-(bromomethyl)-1,3,5-trichlorobenzene. InChIKey: HOXSDYSZXAATIK-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl3 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 2-(bromomethyl)-1,3,5-trichlorobenzene |
| InChIKey | HOXSDYSZXAATIK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CBr)Cl)Cl |
Computed by PubChem (NCBI)