CAS 2174940-53-3 is the registry number for (R)–(1–(2,4–Dichlorophenyl)ethyl)hydrazine hydrochloride. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
[(1R)-1-(2,4-dichlorophenyl)ethyl]hydrazine;hydrochloride (CAS 2174940-53-3) is a chemical compound with the molecular formula C8H11Cl3N2 and a molecular weight of 241.5 g/mol. IUPAC name: [(1R)-1-(2,4-dichlorophenyl)ethyl]hydrazine;hydrochloride. InChIKey: CNSJTJWZIWMNPC-NUBCRITNSA-N.
| Molecular formula | C8H11Cl3N2 |
|---|---|
| Molecular weight | 241.5 g/mol |
| IUPAC name | [(1R)-1-(2,4-dichlorophenyl)ethyl]hydrazine;hydrochloride |
| InChIKey | CNSJTJWZIWMNPC-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)Cl)Cl)NN.Cl |
Computed by PubChem (NCBI)