CAS 2918780-02-4 appears in our catalog under these names: 1-(3,5-Dichlorophenyl)ethane-1,2-diamine hydrochloride, 98%, 1-(3,5-Dichlorophenyl)ethane-1,2-diamine Hydrochloride, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-(3,5-dichlorophenyl)ethane-1,2-diamine;hydrochloride (CAS 2918780-02-4) is a chemical compound with the molecular formula C8H11Cl3N2 and a molecular weight of 241.5 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)ethane-1,2-diamine;hydrochloride. InChIKey: OSIROIHWTRILKH-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl3N2 |
|---|---|
| Molecular weight | 241.5 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)ethane-1,2-diamine;hydrochloride |
| InChIKey | OSIROIHWTRILKH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(CN)N.Cl |
Computed by PubChem (NCBI)