CAS 30595-57-4 is the registry number for (2,4-Dichlorophenethyl)hydrazine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(2,4-dichlorophenyl)ethylhydrazine;hydrochloride (CAS 30595-57-4) is a chemical compound with the molecular formula C8H11Cl3N2 and a molecular weight of 241.5 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)ethylhydrazine;hydrochloride. InChIKey: DLYGFXCKUDCYOC-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl3N2 |
|---|---|
| Molecular weight | 241.5 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)ethylhydrazine;hydrochloride |
| InChIKey | DLYGFXCKUDCYOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CCNN.Cl |
Computed by PubChem (NCBI)