Products 2174971-20-9
CAS 2174971-20-9 is the registry number for [4-Fluoro-2-(pyrrolidin-1-yl)phenyl]boronic acid, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-fluoro-2-pyrrolidin-1-ylphenyl)boronic acid (CAS 2174971-20-9) is a chemical compound with the molecular formula C10H13BFNO2 and a molecular weight of 209.03 g/mol. IUPAC name: (4-fluoro-2-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: IAUIJAYHNCEQGX-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | (4-fluoro-2-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | IAUIJAYHNCEQGX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)N2CCCC2)(O)O |
Computed by PubChem (NCBI)