CAS 1287752-87-7 is the registry number for 3-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoropyridine (CAS 1287752-87-7) is a chemical compound with the molecular formula C10H13BFNO2 and a molecular weight of 209.03 g/mol. IUPAC name: 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoropyridine. InChIKey: BOIUONXXHGWEDN-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoropyridine |
| InChIKey | BOIUONXXHGWEDN-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(N=CC=C2)F |
Computed by PubChem (NCBI)