CAS 1704073-15-3 appears in our catalog under these names: [4-Fluoro-3-(pyrrolidin-1-yl)phenyl]boronic acid, 95%, (4-fluoro-3-(pyrrolidin-1-yl)phenyl)boronic acid, 98+%, (4–Fluoro–3–(pyrrolidin–1–yl)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g.
(4-fluoro-3-pyrrolidin-1-ylphenyl)boronic acid (CAS 1704073-15-3) is a chemical compound with the molecular formula C10H13BFNO2 and a molecular weight of 209.03 g/mol. IUPAC name: (4-fluoro-3-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: WXTMKDJAANPCDQ-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | (4-fluoro-3-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | WXTMKDJAANPCDQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)N2CCCC2)(O)O |
Computed by PubChem (NCBI)