CAS 2095165-17-4 is the registry number for (3–fluoro–4–(pyrrolidin–1–yl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(3-fluoro-4-pyrrolidin-1-ylphenyl)boronic acid (CAS 2095165-17-4) is a chemical compound with the molecular formula C10H13BFNO2 and a molecular weight of 209.03 g/mol. IUPAC name: (3-fluoro-4-pyrrolidin-1-ylphenyl)boronic acid. InChIKey: KTOQDCHUJUSGAV-UHFFFAOYSA-N.
| Molecular formula | C10H13BFNO2 |
|---|---|
| Molecular weight | 209.03 g/mol |
| IUPAC name | (3-fluoro-4-pyrrolidin-1-ylphenyl)boronic acid |
| InChIKey | KTOQDCHUJUSGAV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N2CCCC2)F)(O)O |
Computed by PubChem (NCBI)