CAS 21752-34-1 appears in our catalog under these names: (S)-(-)-N-(1-PHENYLETHYL)SUCCINAMIC ACI&, (S)-4-Oxo-4-((1-phenylethyl)amino)butanoic acid, 97%, 97%, 3-{[(1s)-1-phenylethyl]carbamoyl}propanoic acid, 97%+(LC-MS),RG. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5G, 100mg, 250mg.
4-oxo-4-[[(1S)-1-phenylethyl]amino]butanoic acid (CAS 21752-34-1) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-oxo-4-[[(1S)-1-phenylethyl]amino]butanoic acid. InChIKey: WUEKFTPKHWMMIP-VIFPVBQESA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-oxo-4-[[(1S)-1-phenylethyl]amino]butanoic acid |
| InChIKey | WUEKFTPKHWMMIP-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)