Products 60756-87-8

CAS 60756-87-8 is the registry number for 3-[(1-Phenylethyl)carbamoyl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-oxo-4-(1-phenylethylamino)butanoic acid (CAS 60756-87-8) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-oxo-4-(1-phenylethylamino)butanoic acid. InChIKey: WUEKFTPKHWMMIP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO3
Molecular weight221.25 g/mol
IUPAC name4-oxo-4-(1-phenylethylamino)butanoic acid
InChIKeyWUEKFTPKHWMMIP-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1)NC(=O)CCC(=O)O

Computed by PubChem (NCBI)