CAS 21755-37-3 appears in our catalog under these names: 2-(Imidazo(1,2-a)pyridin-2-yl)acetohydrazide, 97%, 2-{Imidazo(1,2-a)pyridin-2-yl}acetohydrazide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-imidazo[1,2-a]pyridin-2-ylacetohydrazide (CAS 21755-37-3) is a chemical compound with the molecular formula C9H10N4O and a molecular weight of 190.20 g/mol. IUPAC name: 2-imidazo[1,2-a]pyridin-2-ylacetohydrazide. InChIKey: DSRNWRPRNMPQDT-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2-imidazo[1,2-a]pyridin-2-ylacetohydrazide |
| InChIKey | DSRNWRPRNMPQDT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)CC(=O)NN |
Computed by PubChem (NCBI)