Products 21764-41-0
CAS 21764-41-0 is the registry number for Taxoquinone. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,10-dihydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione (CAS 21764-41-0) is a chemical compound with the molecular formula C20H28O4 and a molecular weight of 332.4 g/mol. IUPAC name: 1,10-dihydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione. InChIKey: WAZYPYJGZYLHHT-UHFFFAOYSA-N.
| Molecular formula | C20H28O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 1,10-dihydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione |
| InChIKey | WAZYPYJGZYLHHT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C2=C(C(=O)C1=O)C3(CCCC(C3CC2O)(C)C)C)O |
Computed by PubChem (NCBI)