CAS 217644-02-5 is the registry number for ((1S,2S)-2-Phenylcyclopropyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2S)-2-phenylcyclopropyl]boronic acid (CAS 217644-02-5) is a chemical compound with the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. IUPAC name: [(1S,2S)-2-phenylcyclopropyl]boronic acid. InChIKey: JUMGFYYVCWOJDO-BDAKNGLRSA-N.
| Molecular formula | C9H11BO2 |
|---|---|
| Molecular weight | 162.00 g/mol |
| IUPAC name | [(1S,2S)-2-phenylcyclopropyl]boronic acid |
| InChIKey | JUMGFYYVCWOJDO-BDAKNGLRSA-N |
| SMILES | B([C@H]1C[C@@H]1C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)