Products 1049730-10-0
CAS 1049730-10-0 appears in our catalog under these names: 3-Cyclopropyl-benzeneboronic acid, 98%, 3-Cyclopropylbenzeneboronic acid, 3-Cyclopropylphenylboronic acid, 95%, 95%, (3-cyclopropylphenyl)boronic acid, 98%, (3-Cyclopropylphenyl)boronic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 1g, 250mg, 0,5g, 10g.
(3-cyclopropylphenyl)boronic acid (CAS 1049730-10-0) is a chemical compound with the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. IUPAC name: (3-cyclopropylphenyl)boronic acid. InChIKey: BFFVQXUPALEVGS-UHFFFAOYSA-N.
| Molecular formula | C9H11BO2 |
|---|---|
| Molecular weight | 162.00 g/mol |
| IUPAC name | (3-cyclopropylphenyl)boronic acid |
| InChIKey | BFFVQXUPALEVGS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2CC2)(O)O |
Computed by PubChem (NCBI)