CAS 2249774-32-9 is the registry number for Rel-((1R,2S)-2-phenylcyclopropyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2S)-2-phenylcyclopropyl]boronic acid (CAS 2249774-32-9) is a chemical compound with the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. IUPAC name: [(1R,2S)-2-phenylcyclopropyl]boronic acid. InChIKey: JUMGFYYVCWOJDO-RKDXNWHRSA-N.
| Molecular formula | C9H11BO2 |
|---|---|
| Molecular weight | 162.00 g/mol |
| IUPAC name | [(1R,2S)-2-phenylcyclopropyl]boronic acid |
| InChIKey | JUMGFYYVCWOJDO-RKDXNWHRSA-N |
| SMILES | B([C@@H]1C[C@@H]1C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)