Products 21767-36-2
CAS 21767-36-2 appears in our catalog under these names: 3-(3-(Trifluoromethyl)phenyl)pyrrolidine hydrochloride, 3-[3-(Trifluoromethyl)phenyl]pyrrolidine Hydrochloride, >95%, 3-(3-(Trifluoromethyl)phenyl)pyrrolidine hydrochloride, >95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-[3-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride (CAS 21767-36-2) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride. InChIKey: CEYJDGCARZGVDZ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride |
| InChIKey | CEYJDGCARZGVDZ-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)