CAS 2177255-05-7 appears in our catalog under these names: (1R,4R)-tert-Butyl 1-(hydroxymethyl)-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate, 95%, tert–Butyl (1S)–1–(hydroxymethyl)–2–oxa–5–azabicyclo(2·2·1)heptane–5–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g.
Tert-butyl (1S)-1-(hydroxymethyl)-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate (CAS 2177255-05-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: tert-butyl (1S)-1-(hydroxymethyl)-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate. InChIKey: MXDZFXHHNOXHLF-LYNSQETBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | tert-butyl (1S)-1-(hydroxymethyl)-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate |
| InChIKey | MXDZFXHHNOXHLF-LYNSQETBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@]2(CC1CO2)CO |
Computed by PubChem (NCBI)