CAS 2177258-32-9 appears in our catalog under these names: 3-fluoroquinoline-6-carbonitrile, 95%, 95%, 3-FLUOROQUINOLINE-6-CARBONITRILE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-fluoroquinoline-6-carbonitrile (CAS 2177258-32-9) is a chemical compound with the molecular formula C10H5FN2 and a molecular weight of 172.16 g/mol. IUPAC name: 3-fluoroquinoline-6-carbonitrile. InChIKey: RBVSORAPHLTZKV-UHFFFAOYSA-N.
| Molecular formula | C10H5FN2 |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 3-fluoroquinoline-6-carbonitrile |
| InChIKey | RBVSORAPHLTZKV-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C=C2C=C1C#N)F |
Computed by PubChem (NCBI)