Products 2177265-06-2
CAS 2177265-06-2 appears in our catalog under these names: 6-bromo-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine, 98%, 98%, 6-BROMO-5-(TRIFLUOROMETHYL)-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (CAS 2177265-06-2) is a chemical compound with the molecular formula C7H3BrF3N3 and a molecular weight of 266.02 g/mol. IUPAC name: 6-bromo-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: WNCNKVFBQFWMRN-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3N3 |
|---|---|
| Molecular weight | 266.02 g/mol |
| IUPAC name | 6-bromo-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | WNCNKVFBQFWMRN-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=NN2C(=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)